Designing a Power Divider for Wireless Communications 2: Harmonic Suppression

The power divider is a key component in modern wireless communications systems. It is usually subject to key performance metrics such as low insertion loss, minimal crosstalk between output ports, and a small footprint. In addition, low pass or bandpass filters are typically incorporated in order to suppress unwanted harmonics and noise in wireless signals. These filters should have a sharp response, quantified by the roll-off rate (ROR), and a wide stopband.
In this 3-part notebook series, we will simulate various stages of the design process of a Wilkinson power divider (WPD) created by Moloudian et al in [1].
- In part one, we started with a simple low pass filter design and improved its filter response in order to achieve a higher roll-off rate (ROR).
- In part two (this notebook), we will add a harmonic suppression circuit to the low pass filter to achieve a wide stopband.
- In part three, we will implement the full WPD design and compare its performance to a conventional WPD.
import matplotlib.pyplot as pltimport numpy as npimport flex_rf.tidy3d as rfimport flex_rf.web as webrf.config.logging.level = 'ERROR'General Parameters and Mediums
Section titled “General Parameters and Mediums”The bandwidth of the simulation is defined below. We set a relatively wide range (0.1-16 GHz) to examine the stopband behavior.
(f_min, f_max) = (0.1e9, 16e9)bandwidth = rf.FreqRange.from_freq_interval(f_min, f_max)f0 = bandwidth.freq0freqs = bandwidth.freqs(num_points=601)The substrate is FR4 and the metallic traces are copper. We assume both materials have constant non-zero loss across the bandwidth: loss tangent of 0.022 for FR4 and conductivity of 6E7 S/m (i.e. 60 S/um) for copper.
med_FR4 = rf.FastDispersionFitter.constant_loss_tangent_model(4.4, 0.022, (f_min, f_max))med_Cu = rf.LossyMetalMedium(conductivity=60, frequency_range=(f_min, f_max))Best weighted RMS error so far: 0.003 ━━━━━━━━━━━━━━━━━━━━━━━━━━━━━ 100% 0:00:00
Modified Low-pass Filter
Section titled “Modified Low-pass Filter”For more information on the design of the modified low pass filter, please refer to the first notebook in this series.
Structure
Section titled “Structure”The dimensions of the modified low-pass filter are obtained from [1]. Some dimensions are missing and are estimated visually.
# Geometry dimensionsmm = 1000 # Conversion mm to micronH = 0.8 * mm # Substrate thicknessT = 0.035 * mm # Metal thickness
# Resonator dimensionsMA, MB, MC, MD = (3.9 * mm, 7.1 * mm, 3.1 * mm, 2.3 * mm)ME, MF, MG, MH = (0.6 * mm, 0.2 * mm, 1.2 * mm, 0.5 * mm)MJ, MK, MM, MN = (4.8 * mm, 0.3 * mm, 0.1 * mm, 0.7 * mm)MP, MQ, MR, MS = (0.1 * mm, 0.7 * mm, 0.4 * mm, 0.3 * mm)Lsub, Wsub = (2 * MC + MH, 2 * (MH + MK + MB))# Resonator geometrygeom_patch = rf.Box.from_bounds(rmin=(-MA / 2, MH / 2 + MK, 0), rmax=(MA / 2, MH / 2 + MK + MB, T))geom_hole1 = rf.Box.from_bounds( rmin=(-MH / 2 - MN - MF - ME, MH / 2 + MK + MS, 0), rmax=(-MH / 2 - MN - MF, MH / 2 + MK + MS + MG, T),)geom_hole2 = geom_hole1.translated(2 * (MF + MN) + MH + ME, 0, 0)geom_hole3 = rf.Cylinder(center=(0, MH / 2 + MD + MQ, T / 2), radius=MR, length=T, axis=2)geom_hole4 = geom_hole3.translated(0, MQ + 2 * MR, 0)geom_hole5 = rf.Box.from_bounds( rmin=(-MA / 2 + 1.5 * MF, MH / 2 + MK + MS + MG + MQ, 0), rmax=(-MA / 2 + 1.5 * MF + MM, MH / 2 + MK + MB - MP, T),)geom_hole6 = geom_hole5.translated(-2 * geom_hole5.center[0], 0, 0)geom_hole7 = rf.Box.from_bounds( rmin=(-MH / 2 - MN, MH / 2 + MK, 0), rmax=(MH / 2 + MN, MH / 2 + MD, T))for hole in [geom_hole1, geom_hole2, geom_hole3, geom_hole4, geom_hole5, geom_hole6, geom_hole7]: geom_patch -= hole
geom_line1 = rf.Box.from_bounds(rmin=(-MH / 2, MH / 2, 0), rmax=(MH / 2, MH / 2 + MD, T))geom_resonator_modified = rf.GeometryGroup(geometries=[geom_line1, geom_patch])geom_feedline = rf.Box.from_bounds(rmin=(-MH / 2 - MC, -MH / 2, 0), rmax=(MH / 2 + MC, MH / 2, T))
# Substrate and groundx0, y0, z0 = geom_resonator_modified.bounding_box.centergeom_sub = rf.Box(center=(x0, y0, -H / 2), size=(Lsub, Wsub, H))geom_gnd = rf.Box(center=(x0, y0, -H - T / 2), size=(Lsub, Wsub, T))
# Structuresstr_resonator_modified = rf.Structure(geometry=geom_resonator_modified, medium=med_Cu)str_feedline = rf.Structure(geometry=geom_feedline, medium=med_Cu)str_sub = rf.Structure(geometry=geom_sub, medium=med_FR4)str_gnd = rf.Structure(geometry=geom_gnd, medium=med_Cu)str_list_modified = [str_sub, str_gnd, str_feedline, str_resonator_modified]Monitors and Ports
Section titled “Monitors and Ports”We define an in-plane field monitor for visualization purposes.
# Field Monitorsmon_1 = rf.FieldMonitor( center=(0, 0, 0), size=(rf.inf, rf.inf, 0), freqs=[f_min, f0, f_max], name="field in-plane",)The feedline is terminated by two 50 ohm lumped ports.
# Lumped portlp_options = {"size": (0, MH, H), "voltage_axis": 2, "impedance": 50}LP1 = rf.LumpedPort(center=(-MH / 2 - MC, 0, -H / 2), name="LP1", **lp_options)LP2 = rf.LumpedPort(center=(MH / 2 + MC, 0, -H / 2), name="LP2", **lp_options)port_list = [LP1, LP2] # List of portsGrid and Boundary
Section titled “Grid and Boundary”By default, the simulation boundary is open (PML) on all sides. We add wavelength/4 padding on all sides to ensure the boundaries do not encroach on the near-field.
# Add paddingpadding = rf.C_0 / f0 / 4sim_LX = Lsub + 2*paddingsim_LY = Wsub + 2*paddingsim_LZ = H + 2*paddingWe use LayerRefinementSpec to automatically refine the grid along corners and edges of the metallic traces. The rest of the grid is automatically created with the minimum grid size determined by the wavelength.
# Layer refinement on resonatorlr_spec = rf.LayerRefinementSpec.from_structures( structures=[str_resonator_modified, str_feedline], min_steps_along_axis=1, corner_refinement=rf.GridRefinement(dl=T, num_cells=2),)
# Define overall grid specgrid_spec = rf.GridSpec.auto( wavelength=rf.C_0 / f0, min_steps_per_wvl=12, layer_refinement_specs=[lr_spec],)Define Simulation and TerminalComponentModeler
Section titled “Define Simulation and TerminalComponentModeler”We define the Simulation and TerminalComponentModeler objects below. The latter facilitates a batch port sweep in order to compute the full S-parameter matrix.
# Define simulation objectsim = rf.Simulation( center=(x0, y0, z0), size=(sim_LX, sim_LY, sim_LZ), structures=str_list_modified, grid_spec=grid_spec, monitors=[mon_1], run_time=6e-9, plot_length_units="mm",)# Define TerminalComponentModelertcm = rf.TerminalComponentModeler( simulation=sim, ports=port_list, freqs=freqs, remove_dc_component=False,)Visualization
Section titled “Visualization”The structure layout and simulation grid are visualized below.
# In-planefig, ax = plt.subplots(figsize=(8, 8))tcm.plot_sim(z=0, ax=ax, monitor_alpha=0)tcm.simulation.plot_grid(z=0, ax=ax, hlim=(-5 * mm, 5 * mm), vlim=(-5 * mm, 12 * mm))plt.show()
# Cross section and portfig, ax = plt.subplots(2, 1, figsize=(10, 6), tight_layout=True)tcm.plot_sim(x=-MH / 2 - MC, ax=ax[0], monitor_alpha=0)tcm.simulation.plot_grid(x=-MH / 2 - MC, ax=ax[0], hlim=(-2 * mm, 2 * mm), vlim=(-1 * mm, 0.1 * mm))tcm.plot_sim(y=0, ax=ax[1], monitor_alpha=0)tcm.simulation.plot_grid(y=0, ax=ax[1], hlim=(-5 * mm, 5 * mm), vlim=(-1 * mm, 0.1 * mm))ax[1].set_aspect(2)plt.show()
Running the Simulation
Section titled “Running the Simulation”tcm_data_modified = web.run( tcm, task_name="WPD modified resonator", path="data/tcm_data_modified.hdf5", verbose=False)Results
Section titled “Results”Field Profile
Section titled “Field Profile”The simulation monitor data is stored as dict values in the data attribute of the TerminalComponentModelerData instance. Use the port name as the key to access the data associated with the respective port excitation.
sim_data = tcm_data_modified.data["LP1"]The field amplitude profiles at the minimum and middle frequency points are shown below. The points lie respectively within the pass- and stopbands.
# Field plotsfig, ax = plt.subplots(1, 2, figsize=(10, 6), tight_layout=True)sim_data.plot_field("field in-plane", "E", val="abs", f=f_min, ax=ax[0])ax[0].set_title(f"Field magnitude at f={f_min / 1e9:.1f} GHz")sim_data.plot_field("field in-plane", "E", val="abs", f=f0, ax=ax[1])ax[1].set_title(f"Field magnitude at f={f0 / 1e9:.1f} GHz")for axis in ax: axis.set_xlim(-5 * mm, 5 * mm) axis.set_ylim(-5 * mm, 12 * mm)plt.show()
S-parameters
Section titled “S-parameters”We use the port_in and port_out coordinates to access the specific S-parameter from the full matrix. Note the use of np.conjugate() to convert from the default physics phase convention to the engineering convention.
smat = tcm_data_modified.smatrix()S11 = np.conjugate(smat.data.isel(port_in=0, port_out=0))S21 = np.conjugate(smat.data.isel(port_in=0, port_out=1))S11dB = 20 * np.log10(np.abs(S11))S21dB = 20 * np.log10(np.abs(S21))The insertion and return losses are plotted below. While the modified filter presents a sharp rolloff and a deep resonance above 2 GHz, the signal suppression is less than ideal at higher frequencies (>5 GHz).
fig, ax = plt.subplots(figsize=(10, 5), tight_layout=True)ax.plot(freqs / 1e9, S11dB, "r", label="|S11|")ax.plot(freqs / 1e9, S21dB, "b", label="|S21|")ax.set_title("Insertion and return loss")ax.set_xlabel("f (GHz)")ax.set_ylabel("dB")ax.legend()ax.grid()plt.show()
Harmonic Suppression Structure
Section titled “Harmonic Suppression Structure”In order to widen the stopband of the resonator, we introduce a harmonic suppression structure. The structure consists of a kinked feedline and five side resonator patches. The equivalent circuit is shown below.

The figure above is taken from Figure 4 in [1].
Structure
Section titled “Structure”The geometry dimensions, where available, are taken from [1]. Some dimensions are missing and are instead estimated visually.
# Suppression structure dimensionsSA, SB, SC, SD = (3 * mm, 11.3 * mm, 4.4 * mm, 6.5 * mm)SE, SF, SG, SH = (2.7 * mm, 1 * mm, 1.7 * mm, 3.7 * mm)SK, SL, SM, SN = (0.5 * mm, 1 * mm, 0.5 * mm, 4.6 * mm)SP, SQ, SR, SS, ST = (0.8 * mm, 1.5 * mm, 2 * mm, 5.9 * mm, 4.6 * mm)Lsub2, Wsub2 = (SB + 2 * SC, 2 * (SK + 2 * (SP + ST)))# Side patchesdef create_side_patch(x0, y0): """create side patch geometry with feed input centered at (x0, y0)""" patch_vertices = [x0, y0] + np.array( [ [SK / 2, 0], [SK / 2, SP], [SA / 2, SP], [SA / 2, SP + ST], [-SA / 2, SP + ST], [-SA / 2, SP], [-SK / 2, SP], [-SK / 2, 0], ] ) patch_geom = rf.PolySlab(vertices=patch_vertices, axis=2, slab_bounds=(0, T)) return patch_geom
geom_patch1 = create_side_patch(-(SB + SA) / 2, SK / 2)geom_patch2 = geom_patch1.reflected((0, -1, 0)).translated(0, 0.3 * mm, 0)geom_patch3 = geom_patch1.reflected((1, 0, 0))geom_patch4 = geom_patch3.reflected((0, -1, 0)).translated(0, 0.3 * mm, 0)
# Bent feedlinehalf_bfl_vertices = np.array( [ [-SD / 2, SK / 2], [-SD / 2, -SR / 2 + SK / 2], [-SD / 2 - SM, -SR / 2 + SK / 2], [-SD / 2 - SM, (SR + SK) / 2], [-SD / 2 - SM - SQ, (SR + SK) / 2], [-SD / 2 - SM - SQ, SK / 2], [-SB / 2 - SC, SK / 2], [-SB / 2 - SC, -SK / 2], [-SD / 2 - SM - SQ + SK, -SK / 2], [-SD / 2 - SM - SQ + SK, SR / 2 - SK / 2], [-SD / 2 - SM - SK, SR / 2 - SK / 2], [-SD / 2 - SM - SK, -(SR + SK) / 2], [-SD / 2 + SK, -(SR + SK) / 2], [-SD / 2 + SK, -SK / 2], ])bfl_vertices = np.append(half_bfl_vertices, np.flip(half_bfl_vertices * [-1, 1], axis=0), axis=0)geom_bend_feedline = rf.PolySlab(vertices=bfl_vertices, axis=2, slab_bounds=(0, T))
# Bottom middle resonatorbmres_vertices = np.array( [ [-SK / 2, -SK / 2], [-SK / 2, -SK / 2 - SN], [-SK / 2 - SF, -SK / 2 - SN], [-SK / 2 - SF, -SK / 2 - SN - SK + SH], [-SS / 2, -SK / 2 - SN - SK + SH], [-SS / 2, -SK / 2 - SN - SK], [SS / 2, -SK / 2 - SN - SK], [SS / 2, -SK / 2 - SN - SK + SH], [SK / 2 + SF, -SK / 2 - SN - SK + SH], [SK / 2 + SF, -SK / 2 - SN], [SK / 2, -SK / 2 - SN], [SK / 2, -SK / 2], ])geom_bottom_resonator = rf.PolySlab(vertices=bmres_vertices, axis=2, slab_bounds=(0, T))
# Group all harmonic suppression geometry objectsgeom_harmonic_suppression = rf.GeometryGroup( geometries=[ geom_patch1, geom_patch2, geom_patch3, geom_patch4, geom_bend_feedline, geom_bottom_resonator, ])# Create structuresstr_sub2 = rf.Structure( geometry=rf.Box(center=(0, 0, -H / 2), size=(Lsub2, Wsub2, H)), medium=med_FR4)str_gnd2 = rf.Structure( geometry=rf.Box(center=(0, 0, -H - T / 2), size=(Lsub2, Wsub2, T)), medium=med_Cu)str_harmonic_suppression = rf.Structure(geometry=geom_harmonic_suppression, medium=med_Cu)
str_list_harmonic_suppression = [ str_sub2, str_gnd2, str_harmonic_suppression, str_resonator_modified,]Monitors and Ports
Section titled “Monitors and Ports”We will reuse the monitor defined in the previous section. The lumped ports are shifted slightly to account for the new substrate size.
# Lumped portlp_options = {"size": (0, SK, H), "voltage_axis": 2, "impedance": 50}LP1 = rf.LumpedPort(center=(-Lsub2 / 2, 0, -H / 2), name="LP1", **lp_options)LP2 = rf.LumpedPort(center=(Lsub2 / 2, 0, -H / 2), name="LP2", **lp_options)port_list = [LP1, LP2] # List of portsGrid and Boundary
Section titled “Grid and Boundary”The boundary and grid specifications are same as before.
# Add paddingpadding = rf.C_0 / f0 / 2sim_LX = Lsub2 + paddingsim_LY = Wsub2 + paddingsim_LZ = H + padding# Layer refinement on resonatorlr_spec = rf.LayerRefinementSpec.from_structures( structures=[str_resonator_modified, str_harmonic_suppression], min_steps_along_axis=1, corner_refinement=rf.GridRefinement(dl=T, num_cells=2),)
# Define overall grid specgrid_spec = rf.GridSpec.auto( wavelength=rf.C_0 / f0, min_steps_per_wvl=15, layer_refinement_specs=[lr_spec],)Simulation and TerminalComponentModeler
Section titled “Simulation and TerminalComponentModeler”The harmonic suppression structure is highly resonant at certain frequencies. To capture its behavior down to the -70 dB level, we increased the run_time and reduced the shutoff level. If we were only interested down to -40 dB, it would be OK to cut off the simulation at a much earlier point to save on computational cost.
# Define simulation objectsim = rf.Simulation( center=(0, 0, 0), size=(sim_LX, sim_LY, sim_LZ), structures=str_list_harmonic_suppression, grid_spec=grid_spec, monitors=[mon_1], run_time=40e-9, shutoff=1e-6, plot_length_units="mm",)# Define TerminalComponentModelertcm = rf.TerminalComponentModeler( simulation=sim, ports=port_list, freqs=freqs, remove_dc_component=False,)Visualization
Section titled “Visualization”# In-planefig, ax = plt.subplots(figsize=(8, 8))tcm.plot_sim(z=0, ax=ax, monitor_alpha=0)tcm.simulation.plot_grid(z=0, ax=ax, hlim=(-12 * mm, 12 * mm), vlim=(-12 * mm, 12 * mm))plt.show()
# Cross sectionfig, ax = plt.subplots(2, 1, figsize=(10, 6), tight_layout=True)tcm.plot_sim(x=-Lsub2 / 2, ax=ax[0], monitor_alpha=0)tcm.simulation.plot_grid(x=-Lsub2 / 2, ax=ax[0], hlim=(-2 * mm, 2 * mm), vlim=(-1 * mm, 0.1 * mm))tcm.plot_sim(y=0, ax=ax[1], monitor_alpha=0)tcm.simulation.plot_grid(y=0, ax=ax[1], hlim=(-5 * mm, 5 * mm), vlim=(-1 * mm, 0.1 * mm))ax[1].set_aspect(2)plt.show()
Running the Simulation
Section titled “Running the Simulation”tcm_data_hs = web.run(tcm, task_name="WPD harmonic suppression", path="data/tcm_data_hs.hdf5", verbose=False)Results
Section titled “Results”Field Profile
Section titled “Field Profile”sim_data2 = tcm_data_hs.data["LP1"]As before, we plot the field amplitude profile at the minimum and middle frequency points, showing the difference between passband and stopband behavior.
# Field plotsfig, ax = plt.subplots(1, 2, figsize=(10, 4), tight_layout=True)sim_data2.plot_field("field in-plane", "E", val="abs", f=f_min, ax=ax[0])ax[0].set_title(f"Field magnitude at f={f_min / 1e9:.1f} GHz")sim_data2.plot_field("field in-plane", "E", val="abs", f=f0, ax=ax[1])ax[1].set_title(f"Field magnitude at f={f0 / 1e9:.1f} GHz")for axis in ax: axis.set_xlim(-12 * mm, 12 * mm) axis.set_ylim(-12 * mm, 12 * mm)plt.show()
S-parameters
Section titled “S-parameters”smat2 = tcm_data_hs.smatrix()S11_2 = np.conjugate(smat2.data.isel(port_in=0, port_out=0))S21_2 = np.conjugate(smat2.data.isel(port_in=0, port_out=1))S11dB_2 = 20 * np.log10(np.abs(S11_2))S21dB_2 = 20 * np.log10(np.abs(S21_2))Comparing the return loss of the two devices, we see that adding the suppression structure has improved signal rejection at most frequencies between 2.3 to 14 GHz.
fig, ax = plt.subplots(figsize=(10, 4), tight_layout=True)ax.plot(freqs / 1e9, S11dB, "r--", label="|S11| (resonator only)")ax.plot(freqs / 1e9, S11dB_2, "r", label="|S11| (with harmonic suppression)")ax.add_patch( plt.Rectangle((2.3, 0), 14 - 2.3, -40, fc="gray", alpha=0.2, label="Improved stopband"))ax.set_title("Return loss")ax.set_xlabel("f (GHz)")ax.set_ylabel("dB")ax.legend()ax.grid()plt.show()
Below, we compare the insertion loss of the two structures. The operating frequency and its first 7 harmonics are indicated with black dotted lines. We find better signal rejection at all of the higher harmonics.
fig, ax = plt.subplots(figsize=(10, 4), tight_layout=True)ax.plot(freqs / 1e9, S21dB, "b--", label="|S21| (resonator only)")ax.plot(freqs / 1e9, S21dB_2, "b", label="|S21| (with harmonic suppression)")for f_plot in np.arange(1, 9) * 1.8: ax.axline((f_plot, -70), (f_plot, 0), ls=":", color="black")ax.set_title("Insertion loss")ax.set_xlabel("f (GHz)")ax.set_ylabel("dB")ax.legend()plt.show()
Conclusion
Section titled “Conclusion”In this notebook, we investigated the addition of a harmonic suppression circuit to the previous low-pass filter design. This is shown to improve the stopband performance of the device up to the 7th harmonic. In the next notebook, we will simulate the full Wilkinson power divider using this structure as both branches of the divider.
Reference
Section titled “Reference”[1] Moloudian, G., Soltani, S., Bahrami, S. et al. Design and fabrication of a Wilkinson power divider with harmonic suppression for LTE and GSM applications. Sci Rep 13, 4246 (2023). https://doi.org/10.1038/s41598-023-31019-7